About 3-(difluoromethoxy)-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide
3-(difluoromethoxy)-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide (PubChem CID 2676787) has the molecular formula C11H10F2N2O2S
and a molecular weight of 272.28 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 3-(difluoromethoxy)-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide |
| PubChem CID | 2676787 |
| Molecular Formula | C11H10F2N2O2S |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 3-(difluoromethoxy)-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(NC1=NCCS1)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C11H10F2N2O2S/c12-10(13)17-8-3-1-2-7(6-8)9(16)15-11-14-4-5-18-11/h1-3,6,10H,4-5H2,(H,14,15,16) |
| InChIKey | SXIIWLMZXIGPJU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(difluoromethoxy)-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethoxy)-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide?
The IUPAC name of 3-(difluoromethoxy)-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide (CID 2676787) is 3-(difluoromethoxy)-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for 3-(difluoromethoxy)-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide?
The canonical SMILES for 3-(difluoromethoxy)-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide is O=C(NC1=NCCS1)c1cccc(OC(F)F)c1.
What is the InChIKey of 3-(difluoromethoxy)-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide?
The InChIKey is SXIIWLMZXIGPJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F2N2O2S/c12-10(13)17-8-3-1-2-7(6-8)9(16)15-11-14-4-5-18-11/h1-3,6,10H,4-5H2,(H,14,15,16).
What are the key properties of 3-(difluoromethoxy)-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide?
3-(difluoromethoxy)-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide has a molecular weight of 272.28 g/mol, XLogP of 2.12, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethoxy)-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 2676787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).