C19H19F3N2O3S — CID 26774017
(E)-N-[5-(dimethylsulfamoyl)-2-methylphenyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 26774017) has the molecular formula C19H19F3N2O3S and a molecular weight of 412.43 g/mol. Its IUPAC name is (E)-N-[5-(dimethylsulfamoyl)-2-methylphenyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[5-(dimethylsulfamoyl)-2-methylphenyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 26774017 |
| Molecular Formula | C19H19F3N2O3S |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | (E)-N-[5-(dimethylsulfamoyl)-2-methylphenyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)cc1NC(=O)/C=C/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H19F3N2O3S/c1-13-7-9-16(28(26,27)24(2)3)12-17(13)23-18(25)10-8-14-5-4-6-15(11-14)19(20,21)22/h4-12H,1-3H3,(H,23,25)/b10-8+ |
| InChIKey | QMGKLWQSRZDXAJ-CSKARUKUSA-N |
| XLogP | 3.92 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|