C20H22ClN3O5S — CID 26774161
N-[3-(azepan-1-ylsulfonyl)-4-methylphenyl]-4-chloro-2-nitrobenzamide (PubChem CID 26774161) has the molecular formula C20H22ClN3O5S and a molecular weight of 451.93 g/mol. Its IUPAC name is N-[3-(azepan-1-ylsulfonyl)-4-methylphenyl]-4-chloro-2-nitrobenzamide.
| Compound Name | N-[3-(azepan-1-ylsulfonyl)-4-methylphenyl]-4-chloro-2-nitrobenzamide |
|---|---|
| PubChem CID | 26774161 |
| Molecular Formula | C20H22ClN3O5S |
| Molecular Weight | 451.93 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | N-[3-(azepan-1-ylsulfonyl)-4-methylphenyl]-4-chloro-2-nitrobenzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(Cl)cc2[N+](=O)[O-])cc1S(=O)(=O)N1CCCCCC1 |
| InChI | InChI=1S/C20H22ClN3O5S/c1-14-6-8-16(13-19(14)30(28,29)23-10-4-2-3-5-11-23)22-20(25)17-9-7-15(21)12-18(17)24(26)27/h6-9,12-13H,2-5,10-11H2,1H3,(H,22,25) |
| InChIKey | RSZICPDWLGREQM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.93 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|