C21H23N3O5S — CID 26774617
4-ethoxy-N-[4-[[[(2E,4E)-hexa-2,4-dienoyl]amino]carbamoyl]phenyl]benzenesulfonamide (PubChem CID 26774617) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is 4-ethoxy-N-[4-[[[(2E,4E)-hexa-2,4-dienoyl]amino]carbamoyl]phenyl]benzenesulfonamide.
| Compound Name | 4-ethoxy-N-[4-[[[(2E,4E)-hexa-2,4-dienoyl]amino]carbamoyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 26774617 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 4-ethoxy-N-[4-[[[(2E,4E)-hexa-2,4-dienoyl]amino]carbamoyl]phenyl]benzenesulfonamide |
| SMILES | C/C=C/C=C/C(=O)NNC(=O)c1ccc(NS(=O)(=O)c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C21H23N3O5S/c1-3-5-6-7-20(25)22-23-21(26)16-8-10-17(11-9-16)24-30(27,28)19-14-12-18(13-15-19)29-4-2/h3,5-15,24H,4H2,1-2H3,(H,22,25)(H,23,26)/b5-3+,7-6+ |
| InChIKey | FADWHWCZFCJCRP-TWTPFVCWSA-N |
| XLogP | 2.78 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|