C19H23BrN2O4S2 — CID 26777901
1-(5-bromothiophen-2-yl)sulfonyl-N-[2-(2-methoxyphenyl)ethyl]piperidine-4-carboxamide (PubChem CID 26777901) has the molecular formula C19H23BrN2O4S2 and a molecular weight of 487.44 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-N-[2-(2-methoxyphenyl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-[2-(2-methoxyphenyl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26777901 |
| Molecular Formula | C19H23BrN2O4S2 |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 486.03 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-[2-(2-methoxyphenyl)ethyl]piperidine-4-carboxamide |
| SMILES | COc1ccccc1CCNC(=O)C1CCN(S(=O)(=O)c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C19H23BrN2O4S2/c1-26-16-5-3-2-4-14(16)8-11-21-19(23)15-9-12-22(13-10-15)28(24,25)18-7-6-17(20)27-18/h2-7,15H,8-13H2,1H3,(H,21,23) |
| InChIKey | QVPADQNYYDBIRY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |