C24H26N2O4S — CID 26778064
4-[(2,5-dimethylphenyl)sulfonylamino]-N-[2-(2-methoxyphenyl)ethyl]benzamide (PubChem CID 26778064) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is 4-[(2,5-dimethylphenyl)sulfonylamino]-N-[2-(2-methoxyphenyl)ethyl]benzamide.
| Compound Name | 4-[(2,5-dimethylphenyl)sulfonylamino]-N-[2-(2-methoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 26778064 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 4-[(2,5-dimethylphenyl)sulfonylamino]-N-[2-(2-methoxyphenyl)ethyl]benzamide |
| SMILES | COc1ccccc1CCNC(=O)c1ccc(NS(=O)(=O)c2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C24H26N2O4S/c1-17-8-9-18(2)23(16-17)31(28,29)26-21-12-10-20(11-13-21)24(27)25-15-14-19-6-4-5-7-22(19)30-3/h4-13,16,26H,14-15H2,1-3H3,(H,25,27) |
| InChIKey | LJPBFIRCGLPVSV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |