C20H16Cl2N2O3S — CID 26783572
N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetamide (PubChem CID 26783572) has the molecular formula C20H16Cl2N2O3S and a molecular weight of 435.33 g/mol. Its IUPAC name is N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetamide.
| Compound Name | N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetamide |
|---|---|
| PubChem CID | 26783572 |
| Molecular Formula | C20H16Cl2N2O3S |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetamide |
| SMILES | C[C@H](NC(=O)CN1c2cccc3cccc(c23)S1(=O)=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H16Cl2N2O3S/c1-12(15-9-8-14(21)10-16(15)22)23-19(25)11-24-17-6-2-4-13-5-3-7-18(20(13)17)28(24,26)27/h2-10,12H,11H2,1H3,(H,23,25)/t12-/m0/s1 |
| InChIKey | RZKZKKDXSQLTON-LBPRGKRZSA-N |
| XLogP | 4.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |