About 2-[(2R,6R)-6-methylpiperidin-2-yl]ethanol
2-[(2R,6R)-6-methylpiperidin-2-yl]ethanol (PubChem CID 26792944) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is 2-[(2R,6R)-6-methylpiperidin-2-yl]ethanol.
Molecular Properties
| Compound Name | 2-[(2R,6R)-6-methylpiperidin-2-yl]ethanol |
| PubChem CID | 26792944 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 2-[(2R,6R)-6-methylpiperidin-2-yl]ethanol |
| SMILES | C[C@@H]1CCC[C@H](CCO)N1 |
| InChI | InChI=1S/C8H17NO/c1-7-3-2-4-8(9-7)5-6-10/h7-10H,2-6H2,1H3/t7-,8-/m1/s1 |
| InChIKey | RLVLWHOXXDDCNY-HTQZYQBOSA-N |
| XLogP | 0.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(2R,6R)-6-methylpiperidin-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R,6R)-6-methylpiperidin-2-yl]ethanol?
The IUPAC name of 2-[(2R,6R)-6-methylpiperidin-2-yl]ethanol (CID 26792944) is 2-[(2R,6R)-6-methylpiperidin-2-yl]ethanol.
What is the SMILES notation for 2-[(2R,6R)-6-methylpiperidin-2-yl]ethanol?
The canonical SMILES for 2-[(2R,6R)-6-methylpiperidin-2-yl]ethanol is C[C@@H]1CCC[C@H](CCO)N1.
What is the InChIKey of 2-[(2R,6R)-6-methylpiperidin-2-yl]ethanol?
The InChIKey is RLVLWHOXXDDCNY-HTQZYQBOSA-N. The full InChI is InChI=1S/C8H17NO/c1-7-3-2-4-8(9-7)5-6-10/h7-10H,2-6H2,1H3/t7-,8-/m1/s1.
What are the key properties of 2-[(2R,6R)-6-methylpiperidin-2-yl]ethanol?
2-[(2R,6R)-6-methylpiperidin-2-yl]ethanol has a molecular weight of 143.23 g/mol, XLogP of 0.90, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R,6R)-6-methylpiperidin-2-yl]ethanol is sourced from PubChem (CID 26792944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).