C13H11N3O5S — CID 2679311
methyl 3-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]-5-nitrobenzoate (PubChem CID 2679311) has the molecular formula C13H11N3O5S and a molecular weight of 321.31 g/mol. Its IUPAC name is methyl 3-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]-5-nitrobenzoate.
| Compound Name | methyl 3-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 2679311 |
| Molecular Formula | C13H11N3O5S |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | methyl 3-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(C(=O)Nc2nc(C)cs2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H11N3O5S/c1-7-6-22-13(14-7)15-11(17)8-3-9(12(18)21-2)5-10(4-8)16(19)20/h3-6H,1-2H3,(H,14,15,17) |
| InChIKey | YCGGEAXQUDMTDE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|