C16H14N4O3 — CID 26793272
benzyl N-[2-(benzotriazol-1-yl)-2-oxoethyl]carbamate (PubChem CID 26793272) has the molecular formula C16H14N4O3 and a molecular weight of 310.31 g/mol. Its IUPAC name is benzyl N-[2-(benzotriazol-1-yl)-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[2-(benzotriazol-1-yl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 26793272 |
| Molecular Formula | C16H14N4O3 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | benzyl N-[2-(benzotriazol-1-yl)-2-oxoethyl]carbamate |
| SMILES | O=C(NCC(=O)n1nnc2ccccc21)OCc1ccccc1 |
| InChI | InChI=1S/C16H14N4O3/c21-15(20-14-9-5-4-8-13(14)18-19-20)10-17-16(22)23-11-12-6-2-1-3-7-12/h1-9H,10-11H2,(H,17,22) |
| InChIKey | GXIYFGDLDAFXEF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |