C26H28N2O4S — CID 26795823
N-(2,2-diphenylethyl)-4-methyl-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 26795823) has the molecular formula C26H28N2O4S and a molecular weight of 464.59 g/mol. Its IUPAC name is N-(2,2-diphenylethyl)-4-methyl-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(2,2-diphenylethyl)-4-methyl-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 26795823 |
| Molecular Formula | C26H28N2O4S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | N-(2,2-diphenylethyl)-4-methyl-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | Cc1ccc(C(=O)NCC(c2ccccc2)c2ccccc2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C26H28N2O4S/c1-20-12-13-23(18-25(20)33(30,31)28-14-16-32-17-15-28)26(29)27-19-24(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-13,18,24H,14-17,19H2,1H3,(H,27,29) |
| InChIKey | XBCGBESHUXWTFO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |