C17H17ClN2O5S — CID 2680704
[2-[(3-ethoxycarbonyl-4,5-dimethylthiophen-2-yl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate (PubChem CID 2680704) has the molecular formula C17H17ClN2O5S and a molecular weight of 396.85 g/mol. Its IUPAC name is [2-[(3-ethoxycarbonyl-4,5-dimethylthiophen-2-yl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate.
| Compound Name | [2-[(3-ethoxycarbonyl-4,5-dimethylthiophen-2-yl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 2680704 |
| Molecular Formula | C17H17ClN2O5S |
| Molecular Weight | 396.85 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | [2-[(3-ethoxycarbonyl-4,5-dimethylthiophen-2-yl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COC(=O)c2ccc(Cl)nc2)sc(C)c1C |
| InChI | InChI=1S/C17H17ClN2O5S/c1-4-24-17(23)14-9(2)10(3)26-15(14)20-13(21)8-25-16(22)11-5-6-12(18)19-7-11/h5-7H,4,8H2,1-3H3,(H,20,21) |
| InChIKey | IYBYCLOCCPGMAB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.85 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|