C17H19ClN2O3 — CID 2680971
(5R,6S)-3-[2-(4-chlorophenyl)-2-oxoethyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 2680971) has the molecular formula C17H19ClN2O3 and a molecular weight of 334.80 g/mol. Its IUPAC name is (5R,6S)-3-[2-(4-chlorophenyl)-2-oxoethyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5R,6S)-3-[2-(4-chlorophenyl)-2-oxoethyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 2680971 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | (5R,6S)-3-[2-(4-chlorophenyl)-2-oxoethyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | C[C@H]1CCCC[C@@]12NC(=O)N(CC(=O)c1ccc(Cl)cc1)C2=O |
| InChI | InChI=1S/C17H19ClN2O3/c1-11-4-2-3-9-17(11)15(22)20(16(23)19-17)10-14(21)12-5-7-13(18)8-6-12/h5-8,11H,2-4,9-10H2,1H3,(H,19,23)/t11-,17+/m0/s1 |
| InChIKey | HBHPEJKJCMSDRY-APPDUMDISA-N |
| XLogP | 3.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|