C15H18N4O3S2 — CID 26819578
N-[4-[(2R)-2-methylpiperidin-1-yl]sulfonylphenyl]thiadiazole-4-carboxamide (PubChem CID 26819578) has the molecular formula C15H18N4O3S2 and a molecular weight of 366.47 g/mol. Its IUPAC name is N-[4-[(2R)-2-methylpiperidin-1-yl]sulfonylphenyl]thiadiazole-4-carboxamide.
| Compound Name | N-[4-[(2R)-2-methylpiperidin-1-yl]sulfonylphenyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 26819578 |
| Molecular Formula | C15H18N4O3S2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | N-[4-[(2R)-2-methylpiperidin-1-yl]sulfonylphenyl]thiadiazole-4-carboxamide |
| SMILES | C[C@@H]1CCCCN1S(=O)(=O)c1ccc(NC(=O)c2csnn2)cc1 |
| InChI | InChI=1S/C15H18N4O3S2/c1-11-4-2-3-9-19(11)24(21,22)13-7-5-12(6-8-13)16-15(20)14-10-23-18-17-14/h5-8,10-11H,2-4,9H2,1H3,(H,16,20)/t11-/m1/s1 |
| InChIKey | BPRRISKTWVWFHA-LLVKDONJSA-N |
| XLogP | 2.35 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |