C21H23N3OS2 — CID 26819867
N-[[4-(dimethylamino)phenyl]methyl]-2-pyrrol-1-yl-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxamide (PubChem CID 26819867) has the molecular formula C21H23N3OS2 and a molecular weight of 397.57 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-pyrrol-1-yl-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-pyrrol-1-yl-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxamide |
|---|---|
| PubChem CID | 26819867 |
| Molecular Formula | C21H23N3OS2 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-pyrrol-1-yl-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxamide |
| SMILES | CN(C)c1ccc(CNC(=O)c2c(-n3cccc3)sc3c2CCSC3)cc1 |
| InChI | InChI=1S/C21H23N3OS2/c1-23(2)16-7-5-15(6-8-16)13-22-20(25)19-17-9-12-26-14-18(17)27-21(19)24-10-3-4-11-24/h3-8,10-11H,9,12-14H2,1-2H3,(H,22,25) |
| InChIKey | UDLQOUXFFGNJQR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|