C21H22N2O3 — CID 26823081
(2R)-2-(3,4-dimethylphenoxy)-N-(8-methoxyquinolin-5-yl)propanamide (PubChem CID 26823081) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is (2R)-2-(3,4-dimethylphenoxy)-N-(8-methoxyquinolin-5-yl)propanamide.
| Compound Name | (2R)-2-(3,4-dimethylphenoxy)-N-(8-methoxyquinolin-5-yl)propanamide |
|---|---|
| PubChem CID | 26823081 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (2R)-2-(3,4-dimethylphenoxy)-N-(8-methoxyquinolin-5-yl)propanamide |
| SMILES | COc1ccc(NC(=O)[C@@H](C)Oc2ccc(C)c(C)c2)c2cccnc12 |
| InChI | InChI=1S/C21H22N2O3/c1-13-7-8-16(12-14(13)2)26-15(3)21(24)23-18-9-10-19(25-4)20-17(18)6-5-11-22-20/h5-12,15H,1-4H3,(H,23,24)/t15-/m1/s1 |
| InChIKey | CTYKLJLGZRVACP-OAHLLOKOSA-N |
| XLogP | 4.27 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |