C16H16BrNO3 — CID 2682877
2-(4-bromophenyl)-N-(3,4-dimethoxyphenyl)acetamide (PubChem CID 2682877) has the molecular formula C16H16BrNO3 and a molecular weight of 350.21 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-(4-bromophenyl)-N-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 2682877 |
| Molecular Formula | C16H16BrNO3 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 2-(4-bromophenyl)-N-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)Cc2ccc(Br)cc2)cc1OC |
| InChI | InChI=1S/C16H16BrNO3/c1-20-14-8-7-13(10-15(14)21-2)18-16(19)9-11-3-5-12(17)6-4-11/h3-8,10H,9H2,1-2H3,(H,18,19) |
| InChIKey | IWTUSPZHYLKSDF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |