About furan-2-ylmethyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate
furan-2-ylmethyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 2683129) has the molecular formula C16H16FNO6S
and a molecular weight of 369.37 g/mol. Its IUPAC name is furan-2-ylmethyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate.
Molecular Properties
| Compound Name | furan-2-ylmethyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
| PubChem CID | 2683129 |
| Molecular Formula | C16H16FNO6S |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | furan-2-ylmethyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(OCc1ccco1)c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C16H16FNO6S/c17-14-4-3-12(16(19)24-11-13-2-1-7-23-13)10-15(14)25(20,21)18-5-8-22-9-6-18/h1-4,7,10H,5-6,8-9,11H2 |
| InChIKey | MRROBAIHROHVKZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze furan-2-ylmethyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-ylmethyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate?
The IUPAC name of furan-2-ylmethyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate (CID 2683129) is furan-2-ylmethyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate.
What is the SMILES notation for furan-2-ylmethyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate?
The canonical SMILES for furan-2-ylmethyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate is O=C(OCc1ccco1)c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1.
What is the InChIKey of furan-2-ylmethyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate?
The InChIKey is MRROBAIHROHVKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16FNO6S/c17-14-4-3-12(16(19)24-11-13-2-1-7-23-13)10-15(14)25(20,21)18-5-8-22-9-6-18/h1-4,7,10H,5-6,8-9,11H2.
What are the key properties of furan-2-ylmethyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate?
furan-2-ylmethyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate has a molecular weight of 369.37 g/mol, XLogP of 1.80, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-ylmethyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate is sourced from PubChem (CID 2683129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).