C23H32N2O3 — CID 26834823
N-[(2S)-2-(5-methylfuran-2-yl)-2-(4-methylpiperidin-1-yl)ethyl]-4-propan-2-yloxybenzamide (PubChem CID 26834823) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is N-[(2S)-2-(5-methylfuran-2-yl)-2-(4-methylpiperidin-1-yl)ethyl]-4-propan-2-yloxybenzamide.
| Compound Name | N-[(2S)-2-(5-methylfuran-2-yl)-2-(4-methylpiperidin-1-yl)ethyl]-4-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 26834823 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | N-[(2S)-2-(5-methylfuran-2-yl)-2-(4-methylpiperidin-1-yl)ethyl]-4-propan-2-yloxybenzamide |
| SMILES | Cc1ccc([C@H](CNC(=O)c2ccc(OC(C)C)cc2)N2CCC(C)CC2)o1 |
| InChI | InChI=1S/C23H32N2O3/c1-16(2)27-20-8-6-19(7-9-20)23(26)24-15-21(22-10-5-18(4)28-22)25-13-11-17(3)12-14-25/h5-10,16-17,21H,11-15H2,1-4H3,(H,24,26)/t21-/m0/s1 |
| InChIKey | CLVNNNNQCSYCIZ-NRFANRHFSA-N |
| XLogP | 4.58 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |