C20H21N3O5 — CID 26835382
3-(4-oxoquinazolin-3-yl)-N-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 26835382) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is 3-(4-oxoquinazolin-3-yl)-N-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | 3-(4-oxoquinazolin-3-yl)-N-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 26835382 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 3-(4-oxoquinazolin-3-yl)-N-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(NC(=O)CCn2cnc3ccccc3c2=O)cc(OC)c1OC |
| InChI | InChI=1S/C20H21N3O5/c1-26-16-10-13(11-17(27-2)19(16)28-3)22-18(24)8-9-23-12-21-15-7-5-4-6-14(15)20(23)25/h4-7,10-12H,8-9H2,1-3H3,(H,22,24) |
| InChIKey | RHGBMZSXPKQEMX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |