C22H16FN5O4 — CID 26842235
N-[2-fluoro-5-(2-methyl-4-oxopyrido[2,3-d]pyrimidin-3-yl)phenyl]-2-methyl-3-nitrobenzamide (PubChem CID 26842235) has the molecular formula C22H16FN5O4 and a molecular weight of 433.40 g/mol. Its IUPAC name is N-[2-fluoro-5-(2-methyl-4-oxopyrido[2,3-d]pyrimidin-3-yl)phenyl]-2-methyl-3-nitrobenzamide.
| Compound Name | N-[2-fluoro-5-(2-methyl-4-oxopyrido[2,3-d]pyrimidin-3-yl)phenyl]-2-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 26842235 |
| Molecular Formula | C22H16FN5O4 |
| Molecular Weight | 433.40 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N-[2-fluoro-5-(2-methyl-4-oxopyrido[2,3-d]pyrimidin-3-yl)phenyl]-2-methyl-3-nitrobenzamide |
| SMILES | Cc1c(C(=O)Nc2cc(-n3c(C)nc4ncccc4c3=O)ccc2F)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H16FN5O4/c1-12-15(5-3-7-19(12)28(31)32)21(29)26-18-11-14(8-9-17(18)23)27-13(2)25-20-16(22(27)30)6-4-10-24-20/h3-11H,1-2H3,(H,26,29) |
| InChIKey | GBCNHDOBOUBBPF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|