C22H24N6O4S — CID 26843165
6-[4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]-N-(4-methylphenyl)pyridazin-3-amine (PubChem CID 26843165) has the molecular formula C22H24N6O4S and a molecular weight of 468.54 g/mol. Its IUPAC name is 6-[4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]-N-(4-methylphenyl)pyridazin-3-amine.
| Compound Name | 6-[4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]-N-(4-methylphenyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 26843165 |
| Molecular Formula | C22H24N6O4S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 6-[4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]-N-(4-methylphenyl)pyridazin-3-amine |
| SMILES | Cc1ccc(Nc2ccc(N3CCN(S(=O)(=O)c4cc([N+](=O)[O-])ccc4C)CC3)nn2)cc1 |
| InChI | InChI=1S/C22H24N6O4S/c1-16-3-6-18(7-4-16)23-21-9-10-22(25-24-21)26-11-13-27(14-12-26)33(31,32)20-15-19(28(29)30)8-5-17(20)2/h3-10,15H,11-14H2,1-2H3,(H,23,24) |
| InChIKey | OMGBAZXFEAPMRR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|