C20H14BrF3N2O2 — CID 26843720
N-(4-bromophenyl)-2-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]pyridine-3-carboxamide (PubChem CID 26843720) has the molecular formula C20H14BrF3N2O2 and a molecular weight of 451.24 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | N-(4-bromophenyl)-2-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 26843720 |
| Molecular Formula | C20H14BrF3N2O2 |
| Molecular Weight | 451.24 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | N-(4-bromophenyl)-2-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1)c1cccn(Cc2ccc(C(F)(F)F)cc2)c1=O |
| InChI | InChI=1S/C20H14BrF3N2O2/c21-15-7-9-16(10-8-15)25-18(27)17-2-1-11-26(19(17)28)12-13-3-5-14(6-4-13)20(22,23)24/h1-11H,12H2,(H,25,27) |
| InChIKey | YVATTZMFXPGPTE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.24 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |