About 7-(4-methylsulfonylpiperazin-1-yl)-3-phenyltriazolo[4,5-d]pyrimidine
7-(4-methylsulfonylpiperazin-1-yl)-3-phenyltriazolo[4,5-d]pyrimidine (PubChem CID 26844856) has the molecular formula C15H17N7O2S
and a molecular weight of 359.42 g/mol. Its IUPAC name is 7-(4-methylsulfonylpiperazin-1-yl)-3-phenyltriazolo[4,5-d]pyrimidine.
Molecular Properties
| Compound Name | 7-(4-methylsulfonylpiperazin-1-yl)-3-phenyltriazolo[4,5-d]pyrimidine |
| PubChem CID | 26844856 |
| Molecular Formula | C15H17N7O2S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 7-(4-methylsulfonylpiperazin-1-yl)-3-phenyltriazolo[4,5-d]pyrimidine |
| SMILES | CS(=O)(=O)N1CCN(c2ncnc3c2nnn3-c2ccccc2)CC1 |
| InChI | InChI=1S/C15H17N7O2S/c1-25(23,24)21-9-7-20(8-10-21)14-13-15(17-11-16-14)22(19-18-13)12-5-3-2-4-6-12/h2-6,11H,7-10H2,1H3 |
| InChIKey | LFHCAIOBVJMPHY-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 97.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 7-(4-methylsulfonylpiperazin-1-yl)-3-phenyltriazolo[4,5-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-methylsulfonylpiperazin-1-yl)-3-phenyltriazolo[4,5-d]pyrimidine?
The IUPAC name of 7-(4-methylsulfonylpiperazin-1-yl)-3-phenyltriazolo[4,5-d]pyrimidine (CID 26844856) is 7-(4-methylsulfonylpiperazin-1-yl)-3-phenyltriazolo[4,5-d]pyrimidine.
What is the SMILES notation for 7-(4-methylsulfonylpiperazin-1-yl)-3-phenyltriazolo[4,5-d]pyrimidine?
The canonical SMILES for 7-(4-methylsulfonylpiperazin-1-yl)-3-phenyltriazolo[4,5-d]pyrimidine is CS(=O)(=O)N1CCN(c2ncnc3c2nnn3-c2ccccc2)CC1.
What is the InChIKey of 7-(4-methylsulfonylpiperazin-1-yl)-3-phenyltriazolo[4,5-d]pyrimidine?
The InChIKey is LFHCAIOBVJMPHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N7O2S/c1-25(23,24)21-9-7-20(8-10-21)14-13-15(17-11-16-14)22(19-18-13)12-5-3-2-4-6-12/h2-6,11H,7-10H2,1H3.
What are the key properties of 7-(4-methylsulfonylpiperazin-1-yl)-3-phenyltriazolo[4,5-d]pyrimidine?
7-(4-methylsulfonylpiperazin-1-yl)-3-phenyltriazolo[4,5-d]pyrimidine has a molecular weight of 359.42 g/mol, XLogP of 0.29, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-methylsulfonylpiperazin-1-yl)-3-phenyltriazolo[4,5-d]pyrimidine is sourced from PubChem (CID 26844856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).