C20H17FN4O3 — CID 26845085
1-[2-(4-fluoroanilino)-2-oxoethyl]-N-(4-methylphenyl)-6-oxopyridazine-3-carboxamide (PubChem CID 26845085) has the molecular formula C20H17FN4O3 and a molecular weight of 380.38 g/mol. Its IUPAC name is 1-[2-(4-fluoroanilino)-2-oxoethyl]-N-(4-methylphenyl)-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-[2-(4-fluoroanilino)-2-oxoethyl]-N-(4-methylphenyl)-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 26845085 |
| Molecular Formula | C20H17FN4O3 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 1-[2-(4-fluoroanilino)-2-oxoethyl]-N-(4-methylphenyl)-6-oxopyridazine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(=O)n(CC(=O)Nc3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C20H17FN4O3/c1-13-2-6-16(7-3-13)23-20(28)17-10-11-19(27)25(24-17)12-18(26)22-15-8-4-14(21)5-9-15/h2-11H,12H2,1H3,(H,22,26)(H,23,28) |
| InChIKey | GQFFZZKFMJYQSP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |