C18H18N2O4 — CID 26860466
4-[2-(2-ethoxyphenoxy)acetyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 26860466) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 4-[2-(2-ethoxyphenoxy)acetyl]-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[2-(2-ethoxyphenoxy)acetyl]-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 26860466 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 4-[2-(2-ethoxyphenoxy)acetyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | CCOc1ccccc1OCC(=O)N1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C18H18N2O4/c1-2-23-15-9-5-6-10-16(15)24-12-18(22)20-11-17(21)19-13-7-3-4-8-14(13)20/h3-10H,2,11-12H2,1H3,(H,19,21) |
| InChIKey | KBNPXMYXMUOFJO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |