C20H23N3O6S — CID 26863026
N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylphenyl]-2-(2-nitrophenyl)acetamide (PubChem CID 26863026) has the molecular formula C20H23N3O6S and a molecular weight of 433.49 g/mol. Its IUPAC name is N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylphenyl]-2-(2-nitrophenyl)acetamide.
| Compound Name | N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylphenyl]-2-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 26863026 |
| Molecular Formula | C20H23N3O6S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylphenyl]-2-(2-nitrophenyl)acetamide |
| SMILES | C[C@H]1CN(S(=O)(=O)c2ccc(NC(=O)Cc3ccccc3[N+](=O)[O-])cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C20H23N3O6S/c1-14-12-22(13-15(2)29-14)30(27,28)18-9-7-17(8-10-18)21-20(24)11-16-5-3-4-6-19(16)23(25)26/h3-10,14-15H,11-13H2,1-2H3,(H,21,24)/t14-,15-/m0/s1 |
| InChIKey | KHWMQJDRIYENQM-GJZGRUSLSA-N |
| XLogP | 2.57 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|