C24H32N2O5S — CID 26864527
(3R)-2-(3,4-dimethoxyphenyl)sulfonyl-N-hexyl-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 26864527) has the molecular formula C24H32N2O5S and a molecular weight of 460.60 g/mol. Its IUPAC name is (3R)-2-(3,4-dimethoxyphenyl)sulfonyl-N-hexyl-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3R)-2-(3,4-dimethoxyphenyl)sulfonyl-N-hexyl-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 26864527 |
| Molecular Formula | C24H32N2O5S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | (3R)-2-(3,4-dimethoxyphenyl)sulfonyl-N-hexyl-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | CCCCCCNC(=O)[C@H]1Cc2ccccc2CN1S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C24H32N2O5S/c1-4-5-6-9-14-25-24(27)21-15-18-10-7-8-11-19(18)17-26(21)32(28,29)20-12-13-22(30-2)23(16-20)31-3/h7-8,10-13,16,21H,4-6,9,14-15,17H2,1-3H3,(H,25,27)/t21-/m1/s1 |
| InChIKey | MEBBLSIPBSUOHQ-OAQYLSRUSA-N |
| XLogP | 3.52 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|