C18H20N2O6S — CID 26864927
propyl 4-[(2-methoxy-5-sulfamoylbenzoyl)amino]benzoate (PubChem CID 26864927) has the molecular formula C18H20N2O6S and a molecular weight of 392.43 g/mol. Its IUPAC name is propyl 4-[(2-methoxy-5-sulfamoylbenzoyl)amino]benzoate.
| Compound Name | propyl 4-[(2-methoxy-5-sulfamoylbenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 26864927 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | propyl 4-[(2-methoxy-5-sulfamoylbenzoyl)amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)c2cc(S(N)(=O)=O)ccc2OC)cc1 |
| InChI | InChI=1S/C18H20N2O6S/c1-3-10-26-18(22)12-4-6-13(7-5-12)20-17(21)15-11-14(27(19,23)24)8-9-16(15)25-2/h4-9,11H,3,10H2,1-2H3,(H,20,21)(H2,19,23,24) |
| InChIKey | LDXQHINKYWVVEX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |