C24H23N3O5S — CID 26872673
2-[4-[(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)carbamoyl]phenoxy]-N-(3-methoxyphenyl)acetamide (PubChem CID 26872673) has the molecular formula C24H23N3O5S and a molecular weight of 465.53 g/mol. Its IUPAC name is 2-[4-[(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)carbamoyl]phenoxy]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[4-[(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)carbamoyl]phenoxy]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 26872673 |
| Molecular Formula | C24H23N3O5S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 2-[4-[(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)carbamoyl]phenoxy]-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)COc2ccc(C(=O)NNC(=O)c3cc4c(s3)CCC4)cc2)c1 |
| InChI | InChI=1S/C24H23N3O5S/c1-31-19-6-3-5-17(13-19)25-22(28)14-32-18-10-8-15(9-11-18)23(29)26-27-24(30)21-12-16-4-2-7-20(16)33-21/h3,5-6,8-13H,2,4,7,14H2,1H3,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | FWISXDIAHRTVRL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|