About 3-methyl-1,4-dihydro-2,3-benzoxazine
3-methyl-1,4-dihydro-2,3-benzoxazine (PubChem CID 26875) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 3-methyl-1,4-dihydro-2,3-benzoxazine.
Molecular Properties
| Compound Name | 3-methyl-1,4-dihydro-2,3-benzoxazine |
| PubChem CID | 26875 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 3-methyl-1,4-dihydro-2,3-benzoxazine |
| SMILES | CN1Cc2ccccc2CO1 |
| InChI | InChI=1S/C9H11NO/c1-10-6-8-4-2-3-5-9(8)7-11-10/h2-5H,6-7H2,1H3 |
| InChIKey | SBPYEMSKGZSEGI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-1,4-dihydro-2,3-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,4-dihydro-2,3-benzoxazine?
The IUPAC name of 3-methyl-1,4-dihydro-2,3-benzoxazine (CID 26875) is 3-methyl-1,4-dihydro-2,3-benzoxazine.
What is the SMILES notation for 3-methyl-1,4-dihydro-2,3-benzoxazine?
The canonical SMILES for 3-methyl-1,4-dihydro-2,3-benzoxazine is CN1Cc2ccccc2CO1.
What is the InChIKey of 3-methyl-1,4-dihydro-2,3-benzoxazine?
The InChIKey is SBPYEMSKGZSEGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c1-10-6-8-4-2-3-5-9(8)7-11-10/h2-5H,6-7H2,1H3.
What are the key properties of 3-methyl-1,4-dihydro-2,3-benzoxazine?
3-methyl-1,4-dihydro-2,3-benzoxazine has a molecular weight of 149.19 g/mol, XLogP of 1.56, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,4-dihydro-2,3-benzoxazine is sourced from PubChem (CID 26875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).