C22H21N3O4S — CID 26876416
(2R,7S)-7-methyl-2-[5-(4-methyl-2-nitrophenyl)furan-2-yl]-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 26876416) has the molecular formula C22H21N3O4S and a molecular weight of 423.49 g/mol. Its IUPAC name is (2R,7S)-7-methyl-2-[5-(4-methyl-2-nitrophenyl)furan-2-yl]-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (2R,7S)-7-methyl-2-[5-(4-methyl-2-nitrophenyl)furan-2-yl]-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 26876416 |
| Molecular Formula | C22H21N3O4S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | (2R,7S)-7-methyl-2-[5-(4-methyl-2-nitrophenyl)furan-2-yl]-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc(-c2ccc([C@@H]3NC(=O)c4c(sc5c4CC[C@H](C)C5)N3)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H21N3O4S/c1-11-3-5-13(15(9-11)25(27)28)16-7-8-17(29-16)20-23-21(26)19-14-6-4-12(2)10-18(14)30-22(19)24-20/h3,5,7-9,12,20,24H,4,6,10H2,1-2H3,(H,23,26)/t12-,20+/m0/s1 |
| InChIKey | ZCQJNRBEZCADDU-FKIZINRSSA-N |
| XLogP | 5.20 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|