C25H24ClN3O5 — CID 26879810
3-[(1R,3S,3aR,6aS)-5'-chloro-7'-methyl-2',4,6-trioxo-5-(2-phenylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]propanoic acid (PubChem CID 26879810) has the molecular formula C25H24ClN3O5 and a molecular weight of 481.94 g/mol. Its IUPAC name is 3-[(1R,3S,3aR,6aS)-5'-chloro-7'-methyl-2',4,6-trioxo-5-(2-phenylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]propanoic acid.
| Compound Name | 3-[(1R,3S,3aR,6aS)-5'-chloro-7'-methyl-2',4,6-trioxo-5-(2-phenylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]propanoic acid |
|---|---|
| PubChem CID | 26879810 |
| Molecular Formula | C25H24ClN3O5 |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 3-[(1R,3S,3aR,6aS)-5'-chloro-7'-methyl-2',4,6-trioxo-5-(2-phenylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]propanoic acid |
| SMILES | Cc1cc(Cl)cc2c1NC(=O)[C@@]21N[C@H](CCC(=O)O)[C@H]2C(=O)N(CCc3ccccc3)C(=O)[C@H]21 |
| InChI | InChI=1S/C25H24ClN3O5/c1-13-11-15(26)12-16-21(13)27-24(34)25(16)20-19(17(28-25)7-8-18(30)31)22(32)29(23(20)33)10-9-14-5-3-2-4-6-14/h2-6,11-12,17,19-20,28H,7-10H2,1H3,(H,27,34)(H,30,31)/t17-,19-,20+,25-/m1/s1 |
| InChIKey | CYUKBVOPAXCBNU-NRGSMNHXSA-N |
| XLogP | 2.48 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|