C25H27N3O3S — CID 26883394
(1R,3S,3aR,6aS)-5'-methyl-1-(2-methylsulfanylethyl)-5-(2-phenylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 26883394) has the molecular formula C25H27N3O3S and a molecular weight of 449.58 g/mol. Its IUPAC name is (1R,3S,3aR,6aS)-5'-methyl-1-(2-methylsulfanylethyl)-5-(2-phenylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1R,3S,3aR,6aS)-5'-methyl-1-(2-methylsulfanylethyl)-5-(2-phenylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 26883394 |
| Molecular Formula | C25H27N3O3S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | (1R,3S,3aR,6aS)-5'-methyl-1-(2-methylsulfanylethyl)-5-(2-phenylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | CSCC[C@H]1N[C@@]2(C(=O)Nc3ccc(C)cc32)[C@@H]2C(=O)N(CCc3ccccc3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C25H27N3O3S/c1-15-8-9-18-17(14-15)25(24(31)26-18)21-20(19(27-25)11-13-32-2)22(29)28(23(21)30)12-10-16-6-4-3-5-7-16/h3-9,14,19-21,27H,10-13H2,1-2H3,(H,26,31)/t19-,20-,21+,25-/m1/s1 |
| InChIKey | BDYLUWBKBGWIEL-NAZDKBRTSA-N |
| XLogP | 2.71 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|