C28H24N2O6 — CID 26884587
(3S,4'S)-3'-(2,3-dimethoxyphenyl)-4'-(4-prop-2-enoxybenzoyl)spiro[1H-indole-3,5'-4H-1,2-oxazole]-2-one (PubChem CID 26884587) has the molecular formula C28H24N2O6 and a molecular weight of 484.51 g/mol. Its IUPAC name is (3S,4'S)-3'-(2,3-dimethoxyphenyl)-4'-(4-prop-2-enoxybenzoyl)spiro[1H-indole-3,5'-4H-1,2-oxazole]-2-one.
| Compound Name | (3S,4'S)-3'-(2,3-dimethoxyphenyl)-4'-(4-prop-2-enoxybenzoyl)spiro[1H-indole-3,5'-4H-1,2-oxazole]-2-one |
|---|---|
| PubChem CID | 26884587 |
| Molecular Formula | C28H24N2O6 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | (3S,4'S)-3'-(2,3-dimethoxyphenyl)-4'-(4-prop-2-enoxybenzoyl)spiro[1H-indole-3,5'-4H-1,2-oxazole]-2-one |
| SMILES | C=CCOc1ccc(C(=O)[C@H]2C(c3cccc(OC)c3OC)=NO[C@@]23C(=O)Nc2ccccc23)cc1 |
| InChI | InChI=1S/C28H24N2O6/c1-4-16-35-18-14-12-17(13-15-18)25(31)23-24(19-8-7-11-22(33-2)26(19)34-3)30-36-28(23)20-9-5-6-10-21(20)29-27(28)32/h4-15,23H,1,16H2,2-3H3,(H,29,32)/t23-,28-/m1/s1 |
| InChIKey | FMGZMCAPKIAZLN-QDPGVEIFSA-N |
| XLogP | 4.35 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|