C19H16BrN3O7 — CID 26885735
2-[(5R)-3-(4-bromophenyl)-5-[(2-methoxy-5-nitrophenyl)carbamoyl]-4H-1,2-oxazol-5-yl]acetic acid (PubChem CID 26885735) has the molecular formula C19H16BrN3O7 and a molecular weight of 478.26 g/mol. Its IUPAC name is 2-[(5R)-3-(4-bromophenyl)-5-[(2-methoxy-5-nitrophenyl)carbamoyl]-4H-1,2-oxazol-5-yl]acetic acid.
| Compound Name | 2-[(5R)-3-(4-bromophenyl)-5-[(2-methoxy-5-nitrophenyl)carbamoyl]-4H-1,2-oxazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 26885735 |
| Molecular Formula | C19H16BrN3O7 |
| Molecular Weight | 478.26 g/mol |
| Exact Mass | 477.02 |
| IUPAC Name | 2-[(5R)-3-(4-bromophenyl)-5-[(2-methoxy-5-nitrophenyl)carbamoyl]-4H-1,2-oxazol-5-yl]acetic acid |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@]1(CC(=O)O)CC(c2ccc(Br)cc2)=NO1 |
| InChI | InChI=1S/C19H16BrN3O7/c1-29-16-7-6-13(23(27)28)8-14(16)21-18(26)19(10-17(24)25)9-15(22-30-19)11-2-4-12(20)5-3-11/h2-8H,9-10H2,1H3,(H,21,26)(H,24,25)/t19-/m1/s1 |
| InChIKey | CQZOVNLGZXSIBB-LJQANCHMSA-N |
| XLogP | 3.34 |
| TPSA | 140.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.26 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|