C22H21FN2O3S — CID 26886474
4-[(3,4-dimethylphenyl)sulfonylamino]-N-(4-fluoro-2-methylphenyl)benzamide (PubChem CID 26886474) has the molecular formula C22H21FN2O3S and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-[(3,4-dimethylphenyl)sulfonylamino]-N-(4-fluoro-2-methylphenyl)benzamide.
| Compound Name | 4-[(3,4-dimethylphenyl)sulfonylamino]-N-(4-fluoro-2-methylphenyl)benzamide |
|---|---|
| PubChem CID | 26886474 |
| Molecular Formula | C22H21FN2O3S |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 4-[(3,4-dimethylphenyl)sulfonylamino]-N-(4-fluoro-2-methylphenyl)benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)Nc3ccc(F)cc3C)cc2)cc1C |
| InChI | InChI=1S/C22H21FN2O3S/c1-14-4-10-20(13-15(14)2)29(27,28)25-19-8-5-17(6-9-19)22(26)24-21-11-7-18(23)12-16(21)3/h4-13,25H,1-3H3,(H,24,26) |
| InChIKey | IALCWOUIUJILHQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |