C25H24N2O4S — CID 26889820
(E)-3-[3-(dimethylsulfamoyl)-4-methoxyphenyl]-N-(9H-fluoren-2-yl)prop-2-enamide (PubChem CID 26889820) has the molecular formula C25H24N2O4S and a molecular weight of 448.54 g/mol. Its IUPAC name is (E)-3-[3-(dimethylsulfamoyl)-4-methoxyphenyl]-N-(9H-fluoren-2-yl)prop-2-enamide.
| Compound Name | (E)-3-[3-(dimethylsulfamoyl)-4-methoxyphenyl]-N-(9H-fluoren-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 26889820 |
| Molecular Formula | C25H24N2O4S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | (E)-3-[3-(dimethylsulfamoyl)-4-methoxyphenyl]-N-(9H-fluoren-2-yl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccc3c(c2)Cc2ccccc2-3)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C25H24N2O4S/c1-27(2)32(29,30)24-14-17(8-12-23(24)31-3)9-13-25(28)26-20-10-11-22-19(16-20)15-18-6-4-5-7-21(18)22/h4-14,16H,15H2,1-3H3,(H,26,28)/b13-9+ |
| InChIKey | JZVVBHJAECNSSP-UKTHLTGXSA-N |
| XLogP | 4.17 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|