C19H23NO7S — CID 2689464
[2-[[(6S)-3-ethoxycarbonyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate (PubChem CID 2689464) has the molecular formula C19H23NO7S and a molecular weight of 409.46 g/mol. Its IUPAC name is [2-[[(6S)-3-ethoxycarbonyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate.
| Compound Name | [2-[[(6S)-3-ethoxycarbonyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate |
|---|---|
| PubChem CID | 2689464 |
| Molecular Formula | C19H23NO7S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | [2-[[(6S)-3-ethoxycarbonyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COC(=O)C2=COCCO2)sc2c1CC[C@H](C)C2 |
| InChI | InChI=1S/C19H23NO7S/c1-3-25-19(23)16-12-5-4-11(2)8-14(12)28-17(16)20-15(21)10-27-18(22)13-9-24-6-7-26-13/h9,11H,3-8,10H2,1-2H3,(H,20,21)/t11-/m0/s1 |
| InChIKey | CQFSORBTQDZKHC-NSHDSACASA-N |
| XLogP | 2.42 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |