C19H23NO4 — CID 2689588
[2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] furan-2-carboxylate (PubChem CID 2689588) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] furan-2-carboxylate.
| Compound Name | [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 2689588 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] furan-2-carboxylate |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)COC(=O)c1ccco1 |
| InChI | InChI=1S/C19H23NO4/c1-12(2)14-7-5-8-15(13(3)4)18(14)20-17(21)11-24-19(22)16-9-6-10-23-16/h5-10,12-13H,11H2,1-4H3,(H,20,21) |
| InChIKey | YKEWCZUSPBXZFK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |