About [2-(1H-indol-3-yl)-2-oxoethyl] 3-bromobenzoate
[2-(1H-indol-3-yl)-2-oxoethyl] 3-bromobenzoate (PubChem CID 2689616) has the molecular formula C17H12BrNO3
and a molecular weight of 358.19 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)-2-oxoethyl] 3-bromobenzoate.
Molecular Properties
| Compound Name | [2-(1H-indol-3-yl)-2-oxoethyl] 3-bromobenzoate |
| PubChem CID | 2689616 |
| Molecular Formula | C17H12BrNO3 |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | [2-(1H-indol-3-yl)-2-oxoethyl] 3-bromobenzoate |
| SMILES | O=C(OCC(=O)c1c[nH]c2ccccc12)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H12BrNO3/c18-12-5-3-4-11(8-12)17(21)22-10-16(20)14-9-19-15-7-2-1-6-13(14)15/h1-9,19H,10H2 |
| InChIKey | ZQEYAKALJOYEHJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(1H-indol-3-yl)-2-oxoethyl] 3-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1H-indol-3-yl)-2-oxoethyl] 3-bromobenzoate?
The IUPAC name of [2-(1H-indol-3-yl)-2-oxoethyl] 3-bromobenzoate (CID 2689616) is [2-(1H-indol-3-yl)-2-oxoethyl] 3-bromobenzoate.
What is the SMILES notation for [2-(1H-indol-3-yl)-2-oxoethyl] 3-bromobenzoate?
The canonical SMILES for [2-(1H-indol-3-yl)-2-oxoethyl] 3-bromobenzoate is O=C(OCC(=O)c1c[nH]c2ccccc12)c1cccc(Br)c1.
What is the InChIKey of [2-(1H-indol-3-yl)-2-oxoethyl] 3-bromobenzoate?
The InChIKey is ZQEYAKALJOYEHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12BrNO3/c18-12-5-3-4-11(8-12)17(21)22-10-16(20)14-9-19-15-7-2-1-6-13(14)15/h1-9,19H,10H2.
What are the key properties of [2-(1H-indol-3-yl)-2-oxoethyl] 3-bromobenzoate?
[2-(1H-indol-3-yl)-2-oxoethyl] 3-bromobenzoate has a molecular weight of 358.19 g/mol, XLogP of 3.97, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1H-indol-3-yl)-2-oxoethyl] 3-bromobenzoate is sourced from PubChem (CID 2689616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).