C26H20BrN3O3 — CID 26898382
(3S,3'aS,8'aS,8'bS)-5-bromo-2'-naphthalen-2-ylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione (PubChem CID 26898382) has the molecular formula C26H20BrN3O3 and a molecular weight of 502.37 g/mol. Its IUPAC name is (3S,3'aS,8'aS,8'bS)-5-bromo-2'-naphthalen-2-ylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione.
| Compound Name | (3S,3'aS,8'aS,8'bS)-5-bromo-2'-naphthalen-2-ylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
|---|---|
| PubChem CID | 26898382 |
| Molecular Formula | C26H20BrN3O3 |
| Molecular Weight | 502.37 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | (3S,3'aS,8'aS,8'bS)-5-bromo-2'-naphthalen-2-ylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
| SMILES | O=C1[C@@H]2[C@@H]3CCCN3[C@@]3(C(=O)Nc4ccc(Br)cc43)[C@H]2C(=O)N1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H20BrN3O3/c27-16-8-10-19-18(13-16)26(25(33)28-19)22-21(20-6-3-11-29(20)26)23(31)30(24(22)32)17-9-7-14-4-1-2-5-15(14)12-17/h1-2,4-5,7-10,12-13,20-22H,3,6,11H2,(H,28,33)/t20-,21+,22+,26+/m0/s1 |
| InChIKey | UYIQMEONJNOALH-AVJFOWIRSA-N |
| XLogP | 4.03 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|