C21H24N4O2S — CID 2690061
N-(2,6-dimethylphenyl)-2-[methyl-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methyl]amino]acetamide (PubChem CID 2690061) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[methyl-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methyl]amino]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[methyl-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 2690061 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[methyl-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methyl]amino]acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN(C)Cc1nc2sc3c(c2c(=O)[nH]1)CCC3 |
| InChI | InChI=1S/C21H24N4O2S/c1-12-6-4-7-13(2)19(12)24-17(26)11-25(3)10-16-22-20(27)18-14-8-5-9-15(14)28-21(18)23-16/h4,6-7H,5,8-11H2,1-3H3,(H,24,26)(H,22,23,27) |
| InChIKey | ORCLDAVBZKWPBR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |