C22H21ClN2O3S — CID 26912045
N-[(4-chlorophenyl)methyl]-4-[methyl-(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 26912045) has the molecular formula C22H21ClN2O3S and a molecular weight of 428.94 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-4-[methyl-(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-4-[methyl-(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 26912045 |
| Molecular Formula | C22H21ClN2O3S |
| Molecular Weight | 428.94 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-4-[methyl-(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2ccc(C(=O)NCc3ccc(Cl)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H21ClN2O3S/c1-16-3-13-21(14-4-16)29(27,28)25(2)20-11-7-18(8-12-20)22(26)24-15-17-5-9-19(23)10-6-17/h3-14H,15H2,1-2H3,(H,24,26) |
| InChIKey | IIKPWKDWJFSPOB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.94 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |