C17H15Cl4N3O2 — CID 26912380
[4-(2-methoxyphenyl)piperazin-1-yl]-(3,4,5,6-tetrachloro-2-pyridinyl)methanone (PubChem CID 26912380) has the molecular formula C17H15Cl4N3O2 and a molecular weight of 435.14 g/mol. Its IUPAC name is [4-(2-methoxyphenyl)piperazin-1-yl]-(3,4,5,6-tetrachloro-2-pyridinyl)methanone.
| Compound Name | [4-(2-methoxyphenyl)piperazin-1-yl]-(3,4,5,6-tetrachloro-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 26912380 |
| Molecular Formula | C17H15Cl4N3O2 |
| Molecular Weight | 435.14 g/mol |
| Exact Mass | 432.99 |
| IUPAC Name | [4-(2-methoxyphenyl)piperazin-1-yl]-(3,4,5,6-tetrachloro-2-pyridinyl)methanone |
| SMILES | COc1ccccc1N1CCN(C(=O)c2nc(Cl)c(Cl)c(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C17H15Cl4N3O2/c1-26-11-5-3-2-4-10(11)23-6-8-24(9-7-23)17(25)15-13(19)12(18)14(20)16(21)22-15/h2-5H,6-9H2,1H3 |
| InChIKey | BEXNRMBMXUNHOC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.14 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|