C26H34N2O6S — CID 26918149
ethyl (2Z)-2-[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-3-[2-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetate (PubChem CID 26918149) has the molecular formula C26H34N2O6S and a molecular weight of 502.63 g/mol. Its IUPAC name is ethyl (2Z)-2-[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-3-[2-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-3-[2-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetate |
|---|---|
| PubChem CID | 26918149 |
| Molecular Formula | C26H34N2O6S |
| Molecular Weight | 502.63 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | ethyl (2Z)-2-[(5Z)-5-[(2,4-dimethoxyphenyl)methylidene]-3-[2-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetate |
| SMILES | CCOC(=O)/C=c1\s/c(=C\c2ccc(OC)cc2OC)c(=O)n1CC(=O)N[C@@H]1CCC[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C26H34N2O6S/c1-6-34-25(30)14-24-28(15-23(29)27-20-9-7-8-16(2)17(20)3)26(31)22(35-24)12-18-10-11-19(32-4)13-21(18)33-5/h10-14,16-17,20H,6-9,15H2,1-5H3,(H,27,29)/b22-12-,24-14-/t16-,17-,20+/m0/s1 |
| InChIKey | WZUFIDFJMAVUPY-IGAQJUPBSA-N |
| XLogP | 2.04 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.63 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |