C18H15FN2OS — CID 26927659
3-fluoro-4-methyl-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]benzamide (PubChem CID 26927659) has the molecular formula C18H15FN2OS and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-fluoro-4-methyl-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]benzamide.
| Compound Name | 3-fluoro-4-methyl-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 26927659 |
| Molecular Formula | C18H15FN2OS |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 3-fluoro-4-methyl-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]benzamide |
| SMILES | Cc1nc(-c2cccc(NC(=O)c3ccc(C)c(F)c3)c2)cs1 |
| InChI | InChI=1S/C18H15FN2OS/c1-11-6-7-14(9-16(11)19)18(22)21-15-5-3-4-13(8-15)17-10-23-12(2)20-17/h3-10H,1-2H3,(H,21,22) |
| InChIKey | MSTBAFOEIIEKHZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |