About 1-pyridin-2-yl-2-[(5R)-3,3,5-trimethylcyclohexen-1-yl]hydrazine
1-pyridin-2-yl-2-[(5R)-3,3,5-trimethylcyclohexen-1-yl]hydrazine (PubChem CID 2693022) has the molecular formula C14H21N3
and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-pyridin-2-yl-2-[(5R)-3,3,5-trimethylcyclohexen-1-yl]hydrazine.
Molecular Properties
| Compound Name | 1-pyridin-2-yl-2-[(5R)-3,3,5-trimethylcyclohexen-1-yl]hydrazine |
| PubChem CID | 2693022 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 1-pyridin-2-yl-2-[(5R)-3,3,5-trimethylcyclohexen-1-yl]hydrazine |
| SMILES | C[C@H]1CC(NNc2ccccn2)=CC(C)(C)C1 |
| InChI | InChI=1S/C14H21N3/c1-11-8-12(10-14(2,3)9-11)16-17-13-6-4-5-7-15-13/h4-7,10-11,16H,8-9H2,1-3H3,(H,15,17)/t11-/m0/s1 |
| InChIKey | YHRIJKGQOFKKID-NSHDSACASA-N |
| XLogP | 3.34 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-pyridin-2-yl-2-[(5R)-3,3,5-trimethylcyclohexen-1-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyridin-2-yl-2-[(5R)-3,3,5-trimethylcyclohexen-1-yl]hydrazine?
The IUPAC name of 1-pyridin-2-yl-2-[(5R)-3,3,5-trimethylcyclohexen-1-yl]hydrazine (CID 2693022) is 1-pyridin-2-yl-2-[(5R)-3,3,5-trimethylcyclohexen-1-yl]hydrazine.
What is the SMILES notation for 1-pyridin-2-yl-2-[(5R)-3,3,5-trimethylcyclohexen-1-yl]hydrazine?
The canonical SMILES for 1-pyridin-2-yl-2-[(5R)-3,3,5-trimethylcyclohexen-1-yl]hydrazine is C[C@H]1CC(NNc2ccccn2)=CC(C)(C)C1.
What is the InChIKey of 1-pyridin-2-yl-2-[(5R)-3,3,5-trimethylcyclohexen-1-yl]hydrazine?
The InChIKey is YHRIJKGQOFKKID-NSHDSACASA-N. The full InChI is InChI=1S/C14H21N3/c1-11-8-12(10-14(2,3)9-11)16-17-13-6-4-5-7-15-13/h4-7,10-11,16H,8-9H2,1-3H3,(H,15,17)/t11-/m0/s1.
What are the key properties of 1-pyridin-2-yl-2-[(5R)-3,3,5-trimethylcyclohexen-1-yl]hydrazine?
1-pyridin-2-yl-2-[(5R)-3,3,5-trimethylcyclohexen-1-yl]hydrazine has a molecular weight of 231.34 g/mol, XLogP of 3.34, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyridin-2-yl-2-[(5R)-3,3,5-trimethylcyclohexen-1-yl]hydrazine is sourced from PubChem (CID 2693022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).