C14H18N2O2S — CID 2693066
2-(1,3-benzoxazol-2-ylsulfanyl)-N-pentan-3-ylacetamide (PubChem CID 2693066) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)-N-pentan-3-ylacetamide.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-pentan-3-ylacetamide |
|---|---|
| PubChem CID | 2693066 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-pentan-3-ylacetamide |
| SMILES | CCC(CC)NC(=O)CSc1nc2ccccc2o1 |
| InChI | InChI=1S/C14H18N2O2S/c1-3-10(4-2)15-13(17)9-19-14-16-11-7-5-6-8-12(11)18-14/h5-8,10H,3-4,9H2,1-2H3,(H,15,17) |
| InChIKey | YHDJHPUDTQWOBR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |