C18H21F3N4O3S — CID 26931166
N-[4-(azepan-1-ylsulfonyl)phenyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 26931166) has the molecular formula C18H21F3N4O3S and a molecular weight of 430.45 g/mol. Its IUPAC name is N-[4-(azepan-1-ylsulfonyl)phenyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 26931166 |
| Molecular Formula | C18H21F3N4O3S |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | O=C(Cn1ccc(C(F)(F)F)n1)Nc1ccc(S(=O)(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C18H21F3N4O3S/c19-18(20,21)16-9-12-24(23-16)13-17(26)22-14-5-7-15(8-6-14)29(27,28)25-10-3-1-2-4-11-25/h5-9,12H,1-4,10-11,13H2,(H,22,26) |
| InChIKey | GYYWSBMJEGTGRH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |